C13H22O — CID 89145281
5,7,8-trimethyltricyclo[5.2.1.02,6]decan-8-ol (PubChem CID 89145281) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is 5,7,8-trimethyltricyclo[5.2.1.02,6]decan-8-ol.
| Compound Name | 5,7,8-trimethyltricyclo[5.2.1.02,6]decan-8-ol |
|---|---|
| PubChem CID | 89145281 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | 5,7,8-trimethyltricyclo[5.2.1.02,6]decan-8-ol |
| SMILES | CC1CCC2C3CC(C)(O)C(C)(C3)C12 |
| InChI | InChI=1S/C13H22O/c1-8-4-5-10-9-6-12(2,11(8)10)13(3,14)7-9/h8-11,14H,4-7H2,1-3H3 |
| InChIKey | MSKWUKHIOYNKOD-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |