About 5-ethyl-2-methyl-1,2-thiazolidine
5-ethyl-2-methyl-1,2-thiazolidine (PubChem CID 89145298) has the molecular formula C6H13NS
and a molecular weight of 131.24 g/mol. Its IUPAC name is 5-ethyl-2-methyl-1,2-thiazolidine.
Molecular Properties
| Compound Name | 5-ethyl-2-methyl-1,2-thiazolidine |
| PubChem CID | 89145298 |
| Molecular Formula | C6H13NS |
| Molecular Weight | 131.24 g/mol |
| Exact Mass | 131.08 |
| IUPAC Name | 5-ethyl-2-methyl-1,2-thiazolidine |
| SMILES | CCC1CCN(C)S1 |
| InChI | InChI=1S/C6H13NS/c1-3-6-4-5-7(2)8-6/h6H,3-5H2,1-2H3 |
| InChIKey | NUHFCSUNMIPTIS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.24 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-2-methyl-1,2-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2-methyl-1,2-thiazolidine?
The IUPAC name of 5-ethyl-2-methyl-1,2-thiazolidine (CID 89145298) is 5-ethyl-2-methyl-1,2-thiazolidine.
What is the SMILES notation for 5-ethyl-2-methyl-1,2-thiazolidine?
The canonical SMILES for 5-ethyl-2-methyl-1,2-thiazolidine is CCC1CCN(C)S1.
What is the InChIKey of 5-ethyl-2-methyl-1,2-thiazolidine?
The InChIKey is NUHFCSUNMIPTIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NS/c1-3-6-4-5-7(2)8-6/h6H,3-5H2,1-2H3.
What are the key properties of 5-ethyl-2-methyl-1,2-thiazolidine?
5-ethyl-2-methyl-1,2-thiazolidine has a molecular weight of 131.24 g/mol, XLogP of 1.75, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2-methyl-1,2-thiazolidine is sourced from PubChem (CID 89145298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).