C9H12N2O2 — CID 89145951
4,7-dimethoxy-2,3-dihydro-1H-pyrrolo[2,3-c]pyridine (PubChem CID 89145951) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 4,7-dimethoxy-2,3-dihydro-1H-pyrrolo[2,3-c]pyridine.
| Compound Name | 4,7-dimethoxy-2,3-dihydro-1H-pyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 89145951 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 4,7-dimethoxy-2,3-dihydro-1H-pyrrolo[2,3-c]pyridine |
| SMILES | COc1cnc(OC)c2c1CCN2 |
| InChI | InChI=1S/C9H12N2O2/c1-12-7-5-11-9(13-2)8-6(7)3-4-10-8/h5,10H,3-4H2,1-2H3 |
| InChIKey | VVELGQOIWHPVTO-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |