C7H11F6NO — CID 89146026
2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxy-N-methylethanamine (PubChem CID 89146026) has the molecular formula C7H11F6NO and a molecular weight of 239.16 g/mol. Its IUPAC name is 2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxy-N-methylethanamine.
| Compound Name | 2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxy-N-methylethanamine |
|---|---|
| PubChem CID | 89146026 |
| Molecular Formula | C7H11F6NO |
| Molecular Weight | 239.16 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxy-N-methylethanamine |
| SMILES | CNCCOC(C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H11F6NO/c1-5(6(8,9)10,7(11,12)13)15-4-3-14-2/h14H,3-4H2,1-2H3 |
| InChIKey | KVCULQVEBINIBE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.16 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|