C12H19N — CID 89146241
1-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]pyrrolidine (PubChem CID 89146241) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is 1-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]pyrrolidine.
| Compound Name | 1-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]pyrrolidine |
|---|---|
| PubChem CID | 89146241 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 1-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]pyrrolidine |
| SMILES | C=C/C(C)=C\C=C(/C)N1CCCC1 |
| InChI | InChI=1S/C12H19N/c1-4-11(2)7-8-12(3)13-9-5-6-10-13/h4,7-8H,1,5-6,9-10H2,2-3H3/b11-7-,12-8+ |
| InChIKey | ITGIIVAGSCPCBF-NTLHZVPKSA-N |
| XLogP | 3.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|