About 3-propoxycyclohexa-2,4-diene-1-carbaldehyde
3-propoxycyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 89146276) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is 3-propoxycyclohexa-2,4-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 3-propoxycyclohexa-2,4-diene-1-carbaldehyde |
| PubChem CID | 89146276 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 3-propoxycyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | CCCOC1=CC(C=O)CC=C1 |
| InChI | InChI=1S/C10H14O2/c1-2-6-12-10-5-3-4-9(7-10)8-11/h3,5,7-9H,2,4,6H2,1H3 |
| InChIKey | GUIMGEOXIHVPRZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-propoxycyclohexa-2,4-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propoxycyclohexa-2,4-diene-1-carbaldehyde?
The IUPAC name of 3-propoxycyclohexa-2,4-diene-1-carbaldehyde (CID 89146276) is 3-propoxycyclohexa-2,4-diene-1-carbaldehyde.
What is the SMILES notation for 3-propoxycyclohexa-2,4-diene-1-carbaldehyde?
The canonical SMILES for 3-propoxycyclohexa-2,4-diene-1-carbaldehyde is CCCOC1=CC(C=O)CC=C1.
What is the InChIKey of 3-propoxycyclohexa-2,4-diene-1-carbaldehyde?
The InChIKey is GUIMGEOXIHVPRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2/c1-2-6-12-10-5-3-4-9(7-10)8-11/h3,5,7-9H,2,4,6H2,1H3.
What are the key properties of 3-propoxycyclohexa-2,4-diene-1-carbaldehyde?
3-propoxycyclohexa-2,4-diene-1-carbaldehyde has a molecular weight of 166.22 g/mol, XLogP of 2.07, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propoxycyclohexa-2,4-diene-1-carbaldehyde is sourced from PubChem (CID 89146276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).