C13H23N3O — CID 89146310
N'-ethyl-N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-N'-methyl-2-(methylamino)acetohydrazide (PubChem CID 89146310) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is N'-ethyl-N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-N'-methyl-2-(methylamino)acetohydrazide.
| Compound Name | N'-ethyl-N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-N'-methyl-2-(methylamino)acetohydrazide |
|---|---|
| PubChem CID | 89146310 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | N'-ethyl-N-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-N'-methyl-2-(methylamino)acetohydrazide |
| SMILES | C=C/C=C\C=C(/C)N(C(=O)CNC)N(C)CC |
| InChI | InChI=1S/C13H23N3O/c1-6-8-9-10-12(3)16(15(5)7-2)13(17)11-14-4/h6,8-10,14H,1,7,11H2,2-5H3/b9-8-,12-10+ |
| InChIKey | BBXGVNWUGICWQY-LVQHWDRTSA-N |
| XLogP | 1.55 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|