About 3-bromo-2-chloro-5-ethyl-2,3-dihydrothiophene
3-bromo-2-chloro-5-ethyl-2,3-dihydrothiophene (PubChem CID 89146315) has the molecular formula C6H8BrClS
and a molecular weight of 227.55 g/mol. Its IUPAC name is 3-bromo-2-chloro-5-ethyl-2,3-dihydrothiophene.
Molecular Properties
| Compound Name | 3-bromo-2-chloro-5-ethyl-2,3-dihydrothiophene |
| PubChem CID | 89146315 |
| Molecular Formula | C6H8BrClS |
| Molecular Weight | 227.55 g/mol |
| Exact Mass | 225.92 |
| IUPAC Name | 3-bromo-2-chloro-5-ethyl-2,3-dihydrothiophene |
| SMILES | CCC1=CC(Br)C(Cl)S1 |
| InChI | InChI=1S/C6H8BrClS/c1-2-4-3-5(7)6(8)9-4/h3,5-6H,2H2,1H3 |
| InChIKey | WRUPHADABOHGKF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.55 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-2-chloro-5-ethyl-2,3-dihydrothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-chloro-5-ethyl-2,3-dihydrothiophene?
The IUPAC name of 3-bromo-2-chloro-5-ethyl-2,3-dihydrothiophene (CID 89146315) is 3-bromo-2-chloro-5-ethyl-2,3-dihydrothiophene.
What is the SMILES notation for 3-bromo-2-chloro-5-ethyl-2,3-dihydrothiophene?
The canonical SMILES for 3-bromo-2-chloro-5-ethyl-2,3-dihydrothiophene is CCC1=CC(Br)C(Cl)S1.
What is the InChIKey of 3-bromo-2-chloro-5-ethyl-2,3-dihydrothiophene?
The InChIKey is WRUPHADABOHGKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8BrClS/c1-2-4-3-5(7)6(8)9-4/h3,5-6H,2H2,1H3.
What are the key properties of 3-bromo-2-chloro-5-ethyl-2,3-dihydrothiophene?
3-bromo-2-chloro-5-ethyl-2,3-dihydrothiophene has a molecular weight of 227.55 g/mol, XLogP of 3.36, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-chloro-5-ethyl-2,3-dihydrothiophene is sourced from PubChem (CID 89146315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).