About 2-[(2S)-6,6-dimethyloxan-2-yl]-2-methylpropanenitrile
2-[(2S)-6,6-dimethyloxan-2-yl]-2-methylpropanenitrile (PubChem CID 89146881) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is 2-[(2S)-6,6-dimethyloxan-2-yl]-2-methylpropanenitrile.
Molecular Properties
| Compound Name | 2-[(2S)-6,6-dimethyloxan-2-yl]-2-methylpropanenitrile |
| PubChem CID | 89146881 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 2-[(2S)-6,6-dimethyloxan-2-yl]-2-methylpropanenitrile |
| SMILES | CC1(C)CCC[C@@H](C(C)(C)C#N)O1 |
| InChI | InChI=1S/C11H19NO/c1-10(2,8-12)9-6-5-7-11(3,4)13-9/h9H,5-7H2,1-4H3/t9-/m0/s1 |
| InChIKey | UPAVPHRBAVUPDB-VIFPVBQESA-N |
| XLogP | 2.88 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(2S)-6,6-dimethyloxan-2-yl]-2-methylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S)-6,6-dimethyloxan-2-yl]-2-methylpropanenitrile?
The IUPAC name of 2-[(2S)-6,6-dimethyloxan-2-yl]-2-methylpropanenitrile (CID 89146881) is 2-[(2S)-6,6-dimethyloxan-2-yl]-2-methylpropanenitrile.
What is the SMILES notation for 2-[(2S)-6,6-dimethyloxan-2-yl]-2-methylpropanenitrile?
The canonical SMILES for 2-[(2S)-6,6-dimethyloxan-2-yl]-2-methylpropanenitrile is CC1(C)CCC[C@@H](C(C)(C)C#N)O1.
What is the InChIKey of 2-[(2S)-6,6-dimethyloxan-2-yl]-2-methylpropanenitrile?
The InChIKey is UPAVPHRBAVUPDB-VIFPVBQESA-N. The full InChI is InChI=1S/C11H19NO/c1-10(2,8-12)9-6-5-7-11(3,4)13-9/h9H,5-7H2,1-4H3/t9-/m0/s1.
What are the key properties of 2-[(2S)-6,6-dimethyloxan-2-yl]-2-methylpropanenitrile?
2-[(2S)-6,6-dimethyloxan-2-yl]-2-methylpropanenitrile has a molecular weight of 181.28 g/mol, XLogP of 2.88, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S)-6,6-dimethyloxan-2-yl]-2-methylpropanenitrile is sourced from PubChem (CID 89146881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).