About 7-[amino(methyl)amino]cyclohepta-1,3,6-trien-1-amine
7-[amino(methyl)amino]cyclohepta-1,3,6-trien-1-amine (PubChem CID 89146882) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is 7-[amino(methyl)amino]cyclohepta-1,3,6-trien-1-amine.
Molecular Properties
| Compound Name | 7-[amino(methyl)amino]cyclohepta-1,3,6-trien-1-amine |
| PubChem CID | 89146882 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 7-[amino(methyl)amino]cyclohepta-1,3,6-trien-1-amine |
| SMILES | CN(N)C1=CCC=CC=C1N |
| InChI | InChI=1S/C8H13N3/c1-11(10)8-6-4-2-3-5-7(8)9/h2-3,5-6H,4,9-10H2,1H3 |
| InChIKey | SHKJUZOFOHQWNY-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-[amino(methyl)amino]cyclohepta-1,3,6-trien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[amino(methyl)amino]cyclohepta-1,3,6-trien-1-amine?
The IUPAC name of 7-[amino(methyl)amino]cyclohepta-1,3,6-trien-1-amine (CID 89146882) is 7-[amino(methyl)amino]cyclohepta-1,3,6-trien-1-amine.
What is the SMILES notation for 7-[amino(methyl)amino]cyclohepta-1,3,6-trien-1-amine?
The canonical SMILES for 7-[amino(methyl)amino]cyclohepta-1,3,6-trien-1-amine is CN(N)C1=CCC=CC=C1N.
What is the InChIKey of 7-[amino(methyl)amino]cyclohepta-1,3,6-trien-1-amine?
The InChIKey is SHKJUZOFOHQWNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3/c1-11(10)8-6-4-2-3-5-7(8)9/h2-3,5-6H,4,9-10H2,1H3.
What are the key properties of 7-[amino(methyl)amino]cyclohepta-1,3,6-trien-1-amine?
7-[amino(methyl)amino]cyclohepta-1,3,6-trien-1-amine has a molecular weight of 151.21 g/mol, XLogP of 0.48, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[amino(methyl)amino]cyclohepta-1,3,6-trien-1-amine is sourced from PubChem (CID 89146882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).