C10H15NO3 — CID 89147545
(4S)-2,2-dimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrole-4,5-dicarbaldehyde (PubChem CID 89147545) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is (4S)-2,2-dimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrole-4,5-dicarbaldehyde.
| Compound Name | (4S)-2,2-dimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrole-4,5-dicarbaldehyde |
|---|---|
| PubChem CID | 89147545 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | (4S)-2,2-dimethyl-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrole-4,5-dicarbaldehyde |
| SMILES | CC1(C)CC2C(CN(C=O)[C@@H]2C=O)O1 |
| InChI | InChI=1S/C10H15NO3/c1-10(2)3-7-8(5-12)11(6-13)4-9(7)14-10/h5-9H,3-4H2,1-2H3/t7?,8-,9?/m1/s1 |
| InChIKey | PZLPSXHMSGLJII-QJAFJHJLSA-N |
| XLogP | 0.21 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|