C14H24O5 — CID 89147568
(2S,4S)-2,3,4-tris(prop-2-enoxy)pentane-1,5-diol (PubChem CID 89147568) has the molecular formula C14H24O5 and a molecular weight of 272.34 g/mol. Its IUPAC name is (2S,4S)-2,3,4-tris(prop-2-enoxy)pentane-1,5-diol.
| Compound Name | (2S,4S)-2,3,4-tris(prop-2-enoxy)pentane-1,5-diol |
|---|---|
| PubChem CID | 89147568 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | (2S,4S)-2,3,4-tris(prop-2-enoxy)pentane-1,5-diol |
| SMILES | C=CCOC([C@H](CO)OCC=C)[C@H](CO)OCC=C |
| InChI | InChI=1S/C14H24O5/c1-4-7-17-12(10-15)14(19-9-6-3)13(11-16)18-8-5-2/h4-6,12-16H,1-3,7-11H2/t12-,13-/m0/s1 |
| InChIKey | CVPHGOZHGAXIDL-STQMWFEESA-N |
| XLogP | 0.68 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|