About N-ethyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanamide
N-ethyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanamide (PubChem CID 89147985) has the molecular formula C6H7F6NO2
and a molecular weight of 239.12 g/mol. Its IUPAC name is N-ethyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanamide.
Molecular Properties
| Compound Name | N-ethyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanamide |
| PubChem CID | 89147985 |
| Molecular Formula | C6H7F6NO2 |
| Molecular Weight | 239.12 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | N-ethyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanamide |
| SMILES | CCNC(=O)C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H7F6NO2/c1-2-13-3(14)4(15,5(7,8)9)6(10,11)12/h15H,2H2,1H3,(H,13,14) |
| InChIKey | UDLHHIOQKRFWMP-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.12 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanamide?
The IUPAC name of N-ethyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanamide (CID 89147985) is N-ethyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanamide.
What is the SMILES notation for N-ethyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanamide?
The canonical SMILES for N-ethyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanamide is CCNC(=O)C(O)(C(F)(F)F)C(F)(F)F.
What is the InChIKey of N-ethyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanamide?
The InChIKey is UDLHHIOQKRFWMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7F6NO2/c1-2-13-3(14)4(15,5(7,8)9)6(10,11)12/h15H,2H2,1H3,(H,13,14).
What are the key properties of N-ethyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanamide?
N-ethyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanamide has a molecular weight of 239.12 g/mol, XLogP of 0.98, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanamide is sourced from PubChem (CID 89147985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).