About 5,8-bis(ethenoxy)dodecane
5,8-bis(ethenoxy)dodecane (PubChem CID 89147987) has the molecular formula C16H30O2
and a molecular weight of 254.41 g/mol. Its IUPAC name is 5,8-bis(ethenoxy)dodecane.
Molecular Properties
| Compound Name | 5,8-bis(ethenoxy)dodecane |
| PubChem CID | 89147987 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | 5,8-bis(ethenoxy)dodecane |
| SMILES | C=COC(CCCC)CCC(CCCC)OC=C |
| InChI | InChI=1S/C16H30O2/c1-5-9-11-15(17-7-3)13-14-16(18-8-4)12-10-6-2/h7-8,15-16H,3-6,9-14H2,1-2H3 |
| InChIKey | VPWZHJNRSHXWCM-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 5,8-bis(ethenoxy)dodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,8-bis(ethenoxy)dodecane?
The IUPAC name of 5,8-bis(ethenoxy)dodecane (CID 89147987) is 5,8-bis(ethenoxy)dodecane.
What is the SMILES notation for 5,8-bis(ethenoxy)dodecane?
The canonical SMILES for 5,8-bis(ethenoxy)dodecane is C=COC(CCCC)CCC(CCCC)OC=C.
What is the InChIKey of 5,8-bis(ethenoxy)dodecane?
The InChIKey is VPWZHJNRSHXWCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O2/c1-5-9-11-15(17-7-3)13-14-16(18-8-4)12-10-6-2/h7-8,15-16H,3-6,9-14H2,1-2H3.
What are the key properties of 5,8-bis(ethenoxy)dodecane?
5,8-bis(ethenoxy)dodecane has a molecular weight of 254.41 g/mol, XLogP of 5.20, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8-bis(ethenoxy)dodecane is sourced from PubChem (CID 89147987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).