About 1-O-tert-butyl 6-O-[1-[2-(3-methylpentan-2-yloxy)ethoxy]ethyl] 2-propylhexanedioate
1-O-tert-butyl 6-O-[1-[2-(3-methylpentan-2-yloxy)ethoxy]ethyl] 2-propylhexanedioate (PubChem CID 89147992) has the molecular formula C23H44O6
and a molecular weight of 416.60 g/mol. Its IUPAC name is 1-O-tert-butyl 6-O-[1-[2-(3-methylpentan-2-yloxy)ethoxy]ethyl] 2-propylhexanedioate.
Molecular Properties
| Compound Name | 1-O-tert-butyl 6-O-[1-[2-(3-methylpentan-2-yloxy)ethoxy]ethyl] 2-propylhexanedioate |
| PubChem CID | 89147992 |
| Molecular Formula | C23H44O6 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.31 |
| IUPAC Name | 1-O-tert-butyl 6-O-[1-[2-(3-methylpentan-2-yloxy)ethoxy]ethyl] 2-propylhexanedioate |
| SMILES | CCCC(CCCC(=O)OC(C)OCCOC(C)C(C)CC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H44O6/c1-9-12-20(22(25)29-23(6,7)8)13-11-14-21(24)28-19(5)27-16-15-26-18(4)17(3)10-2/h17-20H,9-16H2,1-8H3 |
| InChIKey | NEERLPSWMPSVRR-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-O-tert-butyl 6-O-[1-[2-(3-methylpentan-2-yloxy)ethoxy]ethyl] 2-propylhexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-tert-butyl 6-O-[1-[2-(3-methylpentan-2-yloxy)ethoxy]ethyl] 2-propylhexanedioate?
The IUPAC name of 1-O-tert-butyl 6-O-[1-[2-(3-methylpentan-2-yloxy)ethoxy]ethyl] 2-propylhexanedioate (CID 89147992) is 1-O-tert-butyl 6-O-[1-[2-(3-methylpentan-2-yloxy)ethoxy]ethyl] 2-propylhexanedioate.
What is the SMILES notation for 1-O-tert-butyl 6-O-[1-[2-(3-methylpentan-2-yloxy)ethoxy]ethyl] 2-propylhexanedioate?
The canonical SMILES for 1-O-tert-butyl 6-O-[1-[2-(3-methylpentan-2-yloxy)ethoxy]ethyl] 2-propylhexanedioate is CCCC(CCCC(=O)OC(C)OCCOC(C)C(C)CC)C(=O)OC(C)(C)C.
What is the InChIKey of 1-O-tert-butyl 6-O-[1-[2-(3-methylpentan-2-yloxy)ethoxy]ethyl] 2-propylhexanedioate?
The InChIKey is NEERLPSWMPSVRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H44O6/c1-9-12-20(22(25)29-23(6,7)8)13-11-14-21(24)28-19(5)27-16-15-26-18(4)17(3)10-2/h17-20H,9-16H2,1-8H3.
What are the key properties of 1-O-tert-butyl 6-O-[1-[2-(3-methylpentan-2-yloxy)ethoxy]ethyl] 2-propylhexanedioate?
1-O-tert-butyl 6-O-[1-[2-(3-methylpentan-2-yloxy)ethoxy]ethyl] 2-propylhexanedioate has a molecular weight of 416.60 g/mol, XLogP of 5.27, 15 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-tert-butyl 6-O-[1-[2-(3-methylpentan-2-yloxy)ethoxy]ethyl] 2-propylhexanedioate is sourced from PubChem (CID 89147992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).