About (2Z,4E)-3-bromo-5-fluorohepta-2,4-dien-2-amine
(2Z,4E)-3-bromo-5-fluorohepta-2,4-dien-2-amine (PubChem CID 89148176) has the molecular formula C7H11BrFN
and a molecular weight of 208.07 g/mol. Its IUPAC name is (2Z,4E)-3-bromo-5-fluorohepta-2,4-dien-2-amine.
Molecular Properties
| Compound Name | (2Z,4E)-3-bromo-5-fluorohepta-2,4-dien-2-amine |
| PubChem CID | 89148176 |
| Molecular Formula | C7H11BrFN |
| Molecular Weight | 208.07 g/mol |
| Exact Mass | 207.01 |
| IUPAC Name | (2Z,4E)-3-bromo-5-fluorohepta-2,4-dien-2-amine |
| SMILES | CC/C(F)=C\C(Br)=C(/C)N |
| InChI | InChI=1S/C7H11BrFN/c1-3-6(9)4-7(8)5(2)10/h4H,3,10H2,1-2H3/b6-4+,7-5- |
| InChIKey | RHSMBJLWSAEIJI-GUBXDBFYSA-N |
| XLogP | 2.83 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.07 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4E)-3-bromo-5-fluorohepta-2,4-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4E)-3-bromo-5-fluorohepta-2,4-dien-2-amine?
The IUPAC name of (2Z,4E)-3-bromo-5-fluorohepta-2,4-dien-2-amine (CID 89148176) is (2Z,4E)-3-bromo-5-fluorohepta-2,4-dien-2-amine.
What is the SMILES notation for (2Z,4E)-3-bromo-5-fluorohepta-2,4-dien-2-amine?
The canonical SMILES for (2Z,4E)-3-bromo-5-fluorohepta-2,4-dien-2-amine is CC/C(F)=C\C(Br)=C(/C)N.
What is the InChIKey of (2Z,4E)-3-bromo-5-fluorohepta-2,4-dien-2-amine?
The InChIKey is RHSMBJLWSAEIJI-GUBXDBFYSA-N. The full InChI is InChI=1S/C7H11BrFN/c1-3-6(9)4-7(8)5(2)10/h4H,3,10H2,1-2H3/b6-4+,7-5-.
What are the key properties of (2Z,4E)-3-bromo-5-fluorohepta-2,4-dien-2-amine?
(2Z,4E)-3-bromo-5-fluorohepta-2,4-dien-2-amine has a molecular weight of 208.07 g/mol, XLogP of 2.83, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4E)-3-bromo-5-fluorohepta-2,4-dien-2-amine is sourced from PubChem (CID 89148176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).