C20H24N4S — CID 89148339
4-N-(4-amino-3,5,5-trimethylcyclohex-3-en-1-yl)thieno[3,2-c]quinoline-4,7-diamine (PubChem CID 89148339) has the molecular formula C20H24N4S and a molecular weight of 352.51 g/mol. Its IUPAC name is 4-N-(4-amino-3,5,5-trimethylcyclohex-3-en-1-yl)thieno[3,2-c]quinoline-4,7-diamine.
| Compound Name | 4-N-(4-amino-3,5,5-trimethylcyclohex-3-en-1-yl)thieno[3,2-c]quinoline-4,7-diamine |
|---|---|
| PubChem CID | 89148339 |
| Molecular Formula | C20H24N4S |
| Molecular Weight | 352.51 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 4-N-(4-amino-3,5,5-trimethylcyclohex-3-en-1-yl)thieno[3,2-c]quinoline-4,7-diamine |
| SMILES | CC1=C(N)C(C)(C)CC(Nc2nc3cc(N)ccc3c3sccc23)C1 |
| InChI | InChI=1S/C20H24N4S/c1-11-8-13(10-20(2,3)18(11)22)23-19-15-6-7-25-17(15)14-5-4-12(21)9-16(14)24-19/h4-7,9,13H,8,10,21-22H2,1-3H3,(H,23,24) |
| InChIKey | PHQDDBDQXGPYFU-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|