C11H18IN3O2 — CID 89148487
2-iodo-3,3-dimethyl-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]butanamide (PubChem CID 89148487) has the molecular formula C11H18IN3O2 and a molecular weight of 351.19 g/mol. Its IUPAC name is 2-iodo-3,3-dimethyl-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]butanamide.
| Compound Name | 2-iodo-3,3-dimethyl-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 89148487 |
| Molecular Formula | C11H18IN3O2 |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 2-iodo-3,3-dimethyl-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]butanamide |
| SMILES | Cc1noc(CCNC(=O)C(I)C(C)(C)C)n1 |
| InChI | InChI=1S/C11H18IN3O2/c1-7-14-8(17-15-7)5-6-13-10(16)9(12)11(2,3)4/h9H,5-6H2,1-4H3,(H,13,16) |
| InChIKey | QDZVPWPSHYOOPN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|