C29H33FN6O4S — CID 89148554
N-[1-[2-[(4-aminophenyl)sulfonylamino]ethylamino]-3,3-dimethyl-1-oxobutan-2-yl]-1-[(4-fluorophenyl)methyl]indazole-3-carboxamide (PubChem CID 89148554) has the molecular formula C29H33FN6O4S and a molecular weight of 580.69 g/mol. Its IUPAC name is N-[1-[2-[(4-aminophenyl)sulfonylamino]ethylamino]-3,3-dimethyl-1-oxobutan-2-yl]-1-[(4-fluorophenyl)methyl]indazole-3-carboxamide.
| Compound Name | N-[1-[2-[(4-aminophenyl)sulfonylamino]ethylamino]-3,3-dimethyl-1-oxobutan-2-yl]-1-[(4-fluorophenyl)methyl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 89148554 |
| Molecular Formula | C29H33FN6O4S |
| Molecular Weight | 580.69 g/mol |
| Exact Mass | 580.23 |
| IUPAC Name | N-[1-[2-[(4-aminophenyl)sulfonylamino]ethylamino]-3,3-dimethyl-1-oxobutan-2-yl]-1-[(4-fluorophenyl)methyl]indazole-3-carboxamide |
| SMILES | CC(C)(C)C(NC(=O)c1nn(Cc2ccc(F)cc2)c2ccccc12)C(=O)NCCNS(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C29H33FN6O4S/c1-29(2,3)26(28(38)32-16-17-33-41(39,40)22-14-12-21(31)13-15-22)34-27(37)25-23-6-4-5-7-24(23)36(35-25)18-19-8-10-20(30)11-9-19/h4-15,26,33H,16-18,31H2,1-3H3,(H,32,38)(H,34,37) |
| InChIKey | RHYNLFOJZJPRTP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 148.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.69 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|