C30H33F3N6O4S — CID 89148592
N-[(2S)-1-[2-[(4-aminophenyl)sulfonylamino]ethylamino]-3,3-dimethyl-1-oxobutan-2-yl]-1-[[4-(trifluoromethyl)phenyl]methyl]indazole-3-carboxamide (PubChem CID 89148592) has the molecular formula C30H33F3N6O4S and a molecular weight of 630.69 g/mol. Its IUPAC name is N-[(2S)-1-[2-[(4-aminophenyl)sulfonylamino]ethylamino]-3,3-dimethyl-1-oxobutan-2-yl]-1-[[4-(trifluoromethyl)phenyl]methyl]indazole-3-carboxamide.
| Compound Name | N-[(2S)-1-[2-[(4-aminophenyl)sulfonylamino]ethylamino]-3,3-dimethyl-1-oxobutan-2-yl]-1-[[4-(trifluoromethyl)phenyl]methyl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 89148592 |
| Molecular Formula | C30H33F3N6O4S |
| Molecular Weight | 630.69 g/mol |
| Exact Mass | 630.22 |
| IUPAC Name | N-[(2S)-1-[2-[(4-aminophenyl)sulfonylamino]ethylamino]-3,3-dimethyl-1-oxobutan-2-yl]-1-[[4-(trifluoromethyl)phenyl]methyl]indazole-3-carboxamide |
| SMILES | CC(C)(C)[C@H](NC(=O)c1nn(Cc2ccc(C(F)(F)F)cc2)c2ccccc12)C(=O)NCCNS(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C30H33F3N6O4S/c1-29(2,3)26(28(41)35-16-17-36-44(42,43)22-14-12-21(34)13-15-22)37-27(40)25-23-6-4-5-7-24(23)39(38-25)18-19-8-10-20(11-9-19)30(31,32)33/h4-15,26,36H,16-18,34H2,1-3H3,(H,35,41)(H,37,40)/t26-/m1/s1 |
| InChIKey | GBZHPLIIJYAEDD-AREMUKBSSA-N |
| XLogP | 3.92 |
| TPSA | 148.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.69 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|