About 1-benzyl-3-[(3Z,5Z)-7-iodohepta-3,5-dienyl]benzimidazol-1-ium
1-benzyl-3-[(3Z,5Z)-7-iodohepta-3,5-dienyl]benzimidazol-1-ium (PubChem CID 89148638) has the molecular formula C21H22IN2+
and a molecular weight of 429.33 g/mol. Its IUPAC name is 1-benzyl-3-[(3Z,5Z)-7-iodohepta-3,5-dienyl]benzimidazol-1-ium.
Molecular Properties
| Compound Name | 1-benzyl-3-[(3Z,5Z)-7-iodohepta-3,5-dienyl]benzimidazol-1-ium |
| PubChem CID | 89148638 |
| Molecular Formula | C21H22IN2+ |
| Molecular Weight | 429.33 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | 1-benzyl-3-[(3Z,5Z)-7-iodohepta-3,5-dienyl]benzimidazol-1-ium |
| SMILES | IC/C=C\C=C/CCn1c[n+](Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C21H22IN2/c22-15-9-2-1-3-10-16-23-18-24(17-19-11-5-4-6-12-19)21-14-8-7-13-20(21)23/h1-9,11-14,18H,10,15-17H2/q+1/b3-1-,9-2- |
| InChIKey | GGWAILATPKPNEN-HCZFIWEASA-N |
| XLogP | 4.91 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.33 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-3-[(3Z,5Z)-7-iodohepta-3,5-dienyl]benzimidazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3-[(3Z,5Z)-7-iodohepta-3,5-dienyl]benzimidazol-1-ium?
The IUPAC name of 1-benzyl-3-[(3Z,5Z)-7-iodohepta-3,5-dienyl]benzimidazol-1-ium (CID 89148638) is 1-benzyl-3-[(3Z,5Z)-7-iodohepta-3,5-dienyl]benzimidazol-1-ium.
What is the SMILES notation for 1-benzyl-3-[(3Z,5Z)-7-iodohepta-3,5-dienyl]benzimidazol-1-ium?
The canonical SMILES for 1-benzyl-3-[(3Z,5Z)-7-iodohepta-3,5-dienyl]benzimidazol-1-ium is IC/C=C\C=C/CCn1c[n+](Cc2ccccc2)c2ccccc21.
What is the InChIKey of 1-benzyl-3-[(3Z,5Z)-7-iodohepta-3,5-dienyl]benzimidazol-1-ium?
The InChIKey is GGWAILATPKPNEN-HCZFIWEASA-N. The full InChI is InChI=1S/C21H22IN2/c22-15-9-2-1-3-10-16-23-18-24(17-19-11-5-4-6-12-19)21-14-8-7-13-20(21)23/h1-9,11-14,18H,10,15-17H2/q+1/b3-1-,9-2-.
What are the key properties of 1-benzyl-3-[(3Z,5Z)-7-iodohepta-3,5-dienyl]benzimidazol-1-ium?
1-benzyl-3-[(3Z,5Z)-7-iodohepta-3,5-dienyl]benzimidazol-1-ium has a molecular weight of 429.33 g/mol, XLogP of 4.91, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3-[(3Z,5Z)-7-iodohepta-3,5-dienyl]benzimidazol-1-ium is sourced from PubChem (CID 89148638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).