C33H34FN5O4S — CID 89148944
3-[[4-[2-[2-[(1Z,3E)-1-amino-4-[(2-methoxyethylamino)methyl]hexa-1,3,5-trienyl]thieno[3,2-b]pyridin-7-yl]ethyl]-3-fluorophenyl]carbamoylamino]benzoic acid (PubChem CID 89148944) has the molecular formula C33H34FN5O4S and a molecular weight of 615.73 g/mol. Its IUPAC name is 3-[[4-[2-[2-[(1Z,3E)-1-amino-4-[(2-methoxyethylamino)methyl]hexa-1,3,5-trienyl]thieno[3,2-b]pyridin-7-yl]ethyl]-3-fluorophenyl]carbamoylamino]benzoic acid.
| Compound Name | 3-[[4-[2-[2-[(1Z,3E)-1-amino-4-[(2-methoxyethylamino)methyl]hexa-1,3,5-trienyl]thieno[3,2-b]pyridin-7-yl]ethyl]-3-fluorophenyl]carbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 89148944 |
| Molecular Formula | C33H34FN5O4S |
| Molecular Weight | 615.73 g/mol |
| Exact Mass | 615.23 |
| IUPAC Name | 3-[[4-[2-[2-[(1Z,3E)-1-amino-4-[(2-methoxyethylamino)methyl]hexa-1,3,5-trienyl]thieno[3,2-b]pyridin-7-yl]ethyl]-3-fluorophenyl]carbamoylamino]benzoic acid |
| SMILES | C=C/C(=C\C=C(/N)c1cc2nccc(CCc3ccc(NC(=O)Nc4cccc(C(=O)O)c4)cc3F)c2s1)CNCCOC |
| InChI | InChI=1S/C33H34FN5O4S/c1-3-21(20-36-15-16-43-2)7-12-28(35)30-19-29-31(44-30)23(13-14-37-29)9-8-22-10-11-26(18-27(22)34)39-33(42)38-25-6-4-5-24(17-25)32(40)41/h3-7,10-14,17-19,36H,1,8-9,15-16,20,35H2,2H3,(H,40,41)(H2,38,39,42)/b21-7+,28-12- |
| InChIKey | TZEYXUAASGLVRB-LCXZYELJSA-N |
| XLogP | 6.21 |
| TPSA | 138.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.73 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|