About 2-amino-1-(dimethylsulfamoylamino)-3,3-dimethylbutane
2-amino-1-(dimethylsulfamoylamino)-3,3-dimethylbutane (PubChem CID 89148987) has the molecular formula C8H21N3O2S
and a molecular weight of 223.34 g/mol. Its IUPAC name is 2-amino-1-(dimethylsulfamoylamino)-3,3-dimethylbutane.
Molecular Properties
| Compound Name | 2-amino-1-(dimethylsulfamoylamino)-3,3-dimethylbutane |
| PubChem CID | 89148987 |
| Molecular Formula | C8H21N3O2S |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 2-amino-1-(dimethylsulfamoylamino)-3,3-dimethylbutane |
| SMILES | CN(C)S(=O)(=O)NCC(N)C(C)(C)C |
| InChI | InChI=1S/C8H21N3O2S/c1-8(2,3)7(9)6-10-14(12,13)11(4)5/h7,10H,6,9H2,1-5H3 |
| InChIKey | SAJRHTKRWUZUDZ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-1-(dimethylsulfamoylamino)-3,3-dimethylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-(dimethylsulfamoylamino)-3,3-dimethylbutane?
The IUPAC name of 2-amino-1-(dimethylsulfamoylamino)-3,3-dimethylbutane (CID 89148987) is 2-amino-1-(dimethylsulfamoylamino)-3,3-dimethylbutane.
What is the SMILES notation for 2-amino-1-(dimethylsulfamoylamino)-3,3-dimethylbutane?
The canonical SMILES for 2-amino-1-(dimethylsulfamoylamino)-3,3-dimethylbutane is CN(C)S(=O)(=O)NCC(N)C(C)(C)C.
What is the InChIKey of 2-amino-1-(dimethylsulfamoylamino)-3,3-dimethylbutane?
The InChIKey is SAJRHTKRWUZUDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H21N3O2S/c1-8(2,3)7(9)6-10-14(12,13)11(4)5/h7,10H,6,9H2,1-5H3.
What are the key properties of 2-amino-1-(dimethylsulfamoylamino)-3,3-dimethylbutane?
2-amino-1-(dimethylsulfamoylamino)-3,3-dimethylbutane has a molecular weight of 223.34 g/mol, XLogP of -0.24, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-(dimethylsulfamoylamino)-3,3-dimethylbutane is sourced from PubChem (CID 89148987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).