About 1-(dimethylsulfamoylamino)-3,3-dimethylbutane
1-(dimethylsulfamoylamino)-3,3-dimethylbutane (PubChem CID 89148999) has the molecular formula C8H20N2O2S
and a molecular weight of 208.33 g/mol. Its IUPAC name is 1-(dimethylsulfamoylamino)-3,3-dimethylbutane.
Molecular Properties
| Compound Name | 1-(dimethylsulfamoylamino)-3,3-dimethylbutane |
| PubChem CID | 89148999 |
| Molecular Formula | C8H20N2O2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 1-(dimethylsulfamoylamino)-3,3-dimethylbutane |
| SMILES | CN(C)S(=O)(=O)NCCC(C)(C)C |
| InChI | InChI=1S/C8H20N2O2S/c1-8(2,3)6-7-9-13(11,12)10(4)5/h9H,6-7H2,1-5H3 |
| InChIKey | HRIBDFYRYXIANG-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(dimethylsulfamoylamino)-3,3-dimethylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dimethylsulfamoylamino)-3,3-dimethylbutane?
The IUPAC name of 1-(dimethylsulfamoylamino)-3,3-dimethylbutane (CID 89148999) is 1-(dimethylsulfamoylamino)-3,3-dimethylbutane.
What is the SMILES notation for 1-(dimethylsulfamoylamino)-3,3-dimethylbutane?
The canonical SMILES for 1-(dimethylsulfamoylamino)-3,3-dimethylbutane is CN(C)S(=O)(=O)NCCC(C)(C)C.
What is the InChIKey of 1-(dimethylsulfamoylamino)-3,3-dimethylbutane?
The InChIKey is HRIBDFYRYXIANG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20N2O2S/c1-8(2,3)6-7-9-13(11,12)10(4)5/h9H,6-7H2,1-5H3.
What are the key properties of 1-(dimethylsulfamoylamino)-3,3-dimethylbutane?
1-(dimethylsulfamoylamino)-3,3-dimethylbutane has a molecular weight of 208.33 g/mol, XLogP of 0.82, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dimethylsulfamoylamino)-3,3-dimethylbutane is sourced from PubChem (CID 89148999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).