C7H11NO2 — CID 89149437
(3aS,4S,6aR)-3,3a,4,5,6,6a-hexahydro-1H-furo[3,4-c]pyrrole-4-carbaldehyde (PubChem CID 89149437) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is (3aS,4S,6aR)-3,3a,4,5,6,6a-hexahydro-1H-furo[3,4-c]pyrrole-4-carbaldehyde.
| Compound Name | (3aS,4S,6aR)-3,3a,4,5,6,6a-hexahydro-1H-furo[3,4-c]pyrrole-4-carbaldehyde |
|---|---|
| PubChem CID | 89149437 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | (3aS,4S,6aR)-3,3a,4,5,6,6a-hexahydro-1H-furo[3,4-c]pyrrole-4-carbaldehyde |
| SMILES | O=C[C@H]1NC[C@@H]2COC[C@@H]21 |
| InChI | InChI=1S/C7H11NO2/c9-2-7-6-4-10-3-5(6)1-8-7/h2,5-8H,1,3-4H2/t5-,6+,7-/m1/s1 |
| InChIKey | ZDORZWUZZAATOH-DSYKOEDSSA-N |
| XLogP | -0.58 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|