About N-piperidin-4-yl-1,2-dihydropyrazin-5-amine
N-piperidin-4-yl-1,2-dihydropyrazin-5-amine (PubChem CID 89149707) has the molecular formula C9H16N4
and a molecular weight of 180.25 g/mol. Its IUPAC name is N-piperidin-4-yl-1,2-dihydropyrazin-5-amine.
Molecular Properties
| Compound Name | N-piperidin-4-yl-1,2-dihydropyrazin-5-amine |
| PubChem CID | 89149707 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | N-piperidin-4-yl-1,2-dihydropyrazin-5-amine |
| SMILES | C1=NC(NC2CCNCC2)=CNC1 |
| InChI | InChI=1S/C9H16N4/c1-3-10-4-2-8(1)13-9-7-11-5-6-12-9/h6-8,10-11,13H,1-5H2 |
| InChIKey | KAYJEWBFBJQIIQ-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-piperidin-4-yl-1,2-dihydropyrazin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-piperidin-4-yl-1,2-dihydropyrazin-5-amine?
The IUPAC name of N-piperidin-4-yl-1,2-dihydropyrazin-5-amine (CID 89149707) is N-piperidin-4-yl-1,2-dihydropyrazin-5-amine.
What is the SMILES notation for N-piperidin-4-yl-1,2-dihydropyrazin-5-amine?
The canonical SMILES for N-piperidin-4-yl-1,2-dihydropyrazin-5-amine is C1=NC(NC2CCNCC2)=CNC1.
What is the InChIKey of N-piperidin-4-yl-1,2-dihydropyrazin-5-amine?
The InChIKey is KAYJEWBFBJQIIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4/c1-3-10-4-2-8(1)13-9-7-11-5-6-12-9/h6-8,10-11,13H,1-5H2.
What are the key properties of N-piperidin-4-yl-1,2-dihydropyrazin-5-amine?
N-piperidin-4-yl-1,2-dihydropyrazin-5-amine has a molecular weight of 180.25 g/mol, XLogP of -0.20, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-piperidin-4-yl-1,2-dihydropyrazin-5-amine is sourced from PubChem (CID 89149707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).