C23H32FN3O6 — CID 89149862
[(3S,4R,6R)-5-azido-4-(2,2-dimethylpropanoyloxy)-3-fluoro-6-phenylmethoxyoxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 89149862) has the molecular formula C23H32FN3O6 and a molecular weight of 465.52 g/mol. Its IUPAC name is [(3S,4R,6R)-5-azido-4-(2,2-dimethylpropanoyloxy)-3-fluoro-6-phenylmethoxyoxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(3S,4R,6R)-5-azido-4-(2,2-dimethylpropanoyloxy)-3-fluoro-6-phenylmethoxyoxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 89149862 |
| Molecular Formula | C23H32FN3O6 |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | [(3S,4R,6R)-5-azido-4-(2,2-dimethylpropanoyloxy)-3-fluoro-6-phenylmethoxyoxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCC1O[C@@H](OCc2ccccc2)C(N=[N+]=[N-])[C@@H](OC(=O)C(C)(C)C)[C@@H]1F |
| InChI | InChI=1S/C23H32FN3O6/c1-22(2,3)20(28)31-13-15-16(24)18(33-21(29)23(4,5)6)17(26-27-25)19(32-15)30-12-14-10-8-7-9-11-14/h7-11,15-19H,12-13H2,1-6H3/t15?,16-,17?,18+,19-/m1/s1 |
| InChIKey | FBVKCJWQFKTFBM-HFOXXNMBSA-N |
| XLogP | 4.49 |
| TPSA | 119.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|