About 2-(5-methoxycyclohexa-2,4-dien-1-yl)acetic acid
2-(5-methoxycyclohexa-2,4-dien-1-yl)acetic acid (PubChem CID 89149868) has the molecular formula C9H12O3
and a molecular weight of 168.19 g/mol. Its IUPAC name is 2-(5-methoxycyclohexa-2,4-dien-1-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(5-methoxycyclohexa-2,4-dien-1-yl)acetic acid |
| PubChem CID | 89149868 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 2-(5-methoxycyclohexa-2,4-dien-1-yl)acetic acid |
| SMILES | COC1=CC=CC(CC(=O)O)C1 |
| InChI | InChI=1S/C9H12O3/c1-12-8-4-2-3-7(5-8)6-9(10)11/h2-4,7H,5-6H2,1H3,(H,10,11) |
| InChIKey | OLQFBWVIKZMXQR-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(5-methoxycyclohexa-2,4-dien-1-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methoxycyclohexa-2,4-dien-1-yl)acetic acid?
The IUPAC name of 2-(5-methoxycyclohexa-2,4-dien-1-yl)acetic acid (CID 89149868) is 2-(5-methoxycyclohexa-2,4-dien-1-yl)acetic acid.
What is the SMILES notation for 2-(5-methoxycyclohexa-2,4-dien-1-yl)acetic acid?
The canonical SMILES for 2-(5-methoxycyclohexa-2,4-dien-1-yl)acetic acid is COC1=CC=CC(CC(=O)O)C1.
What is the InChIKey of 2-(5-methoxycyclohexa-2,4-dien-1-yl)acetic acid?
The InChIKey is OLQFBWVIKZMXQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3/c1-12-8-4-2-3-7(5-8)6-9(10)11/h2-4,7H,5-6H2,1H3,(H,10,11).
What are the key properties of 2-(5-methoxycyclohexa-2,4-dien-1-yl)acetic acid?
2-(5-methoxycyclohexa-2,4-dien-1-yl)acetic acid has a molecular weight of 168.19 g/mol, XLogP of 1.57, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methoxycyclohexa-2,4-dien-1-yl)acetic acid is sourced from PubChem (CID 89149868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).