C20H21FN8O2S — CID 89149888
N'-[N-ethenyl-3-[[5-fluoro-4-[2-(methanesulfonamido)anilino]pyrimidin-2-yl]amino]anilino]methanimidamide (PubChem CID 89149888) has the molecular formula C20H21FN8O2S and a molecular weight of 456.51 g/mol. Its IUPAC name is N'-[N-ethenyl-3-[[5-fluoro-4-[2-(methanesulfonamido)anilino]pyrimidin-2-yl]amino]anilino]methanimidamide.
| Compound Name | N'-[N-ethenyl-3-[[5-fluoro-4-[2-(methanesulfonamido)anilino]pyrimidin-2-yl]amino]anilino]methanimidamide |
|---|---|
| PubChem CID | 89149888 |
| Molecular Formula | C20H21FN8O2S |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | N'-[N-ethenyl-3-[[5-fluoro-4-[2-(methanesulfonamido)anilino]pyrimidin-2-yl]amino]anilino]methanimidamide |
| SMILES | C=CN(/N=C\N)c1cccc(Nc2ncc(F)c(Nc3ccccc3NS(C)(=O)=O)n2)c1 |
| InChI | InChI=1S/C20H21FN8O2S/c1-3-29(24-13-22)15-8-6-7-14(11-15)25-20-23-12-16(21)19(27-20)26-17-9-4-5-10-18(17)28-32(2,30)31/h3-13,28H,1H2,2H3,(H2,22,24)(H2,23,25,26,27) |
| InChIKey | PWRCZKFZVYFKHK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 137.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|