C8H11ClN2 — CID 89150066
1-chloro-2-[(3E,5Z)-octa-1,3,5,7-tetraen-3-yl]hydrazine (PubChem CID 89150066) has the molecular formula C8H11ClN2 and a molecular weight of 170.64 g/mol. Its IUPAC name is 1-chloro-2-[(3E,5Z)-octa-1,3,5,7-tetraen-3-yl]hydrazine.
| Compound Name | 1-chloro-2-[(3E,5Z)-octa-1,3,5,7-tetraen-3-yl]hydrazine |
|---|---|
| PubChem CID | 89150066 |
| Molecular Formula | C8H11ClN2 |
| Molecular Weight | 170.64 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 1-chloro-2-[(3E,5Z)-octa-1,3,5,7-tetraen-3-yl]hydrazine |
| SMILES | C=C/C=C\C=C(/C=C)NNCl |
| InChI | InChI=1S/C8H11ClN2/c1-3-5-6-7-8(4-2)10-11-9/h3-7,10-11H,1-2H2/b6-5-,8-7+ |
| InChIKey | UQFZSJQATLIQSD-IGTJQSIKSA-N |
| XLogP | 2.05 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.64 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|