About 1-[6-(3-methylbut-2-enoxy)-5-(2-methylbut-3-en-2-yl)cyclohexa-1,5-dien-1-yl]ethanone
1-[6-(3-methylbut-2-enoxy)-5-(2-methylbut-3-en-2-yl)cyclohexa-1,5-dien-1-yl]ethanone (PubChem CID 89150085) has the molecular formula C18H26O2
and a molecular weight of 274.40 g/mol. Its IUPAC name is 1-[6-(3-methylbut-2-enoxy)-5-(2-methylbut-3-en-2-yl)cyclohexa-1,5-dien-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[6-(3-methylbut-2-enoxy)-5-(2-methylbut-3-en-2-yl)cyclohexa-1,5-dien-1-yl]ethanone |
| PubChem CID | 89150085 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 1-[6-(3-methylbut-2-enoxy)-5-(2-methylbut-3-en-2-yl)cyclohexa-1,5-dien-1-yl]ethanone |
| SMILES | C=CC(C)(C)C1=C(OCC=C(C)C)C(C(C)=O)=CCC1 |
| InChI | InChI=1S/C18H26O2/c1-7-18(5,6)16-10-8-9-15(14(4)19)17(16)20-12-11-13(2)3/h7,9,11H,1,8,10,12H2,2-6H3 |
| InChIKey | WQRREVCOUZXULE-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[6-(3-methylbut-2-enoxy)-5-(2-methylbut-3-en-2-yl)cyclohexa-1,5-dien-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-(3-methylbut-2-enoxy)-5-(2-methylbut-3-en-2-yl)cyclohexa-1,5-dien-1-yl]ethanone?
The IUPAC name of 1-[6-(3-methylbut-2-enoxy)-5-(2-methylbut-3-en-2-yl)cyclohexa-1,5-dien-1-yl]ethanone (CID 89150085) is 1-[6-(3-methylbut-2-enoxy)-5-(2-methylbut-3-en-2-yl)cyclohexa-1,5-dien-1-yl]ethanone.
What is the SMILES notation for 1-[6-(3-methylbut-2-enoxy)-5-(2-methylbut-3-en-2-yl)cyclohexa-1,5-dien-1-yl]ethanone?
The canonical SMILES for 1-[6-(3-methylbut-2-enoxy)-5-(2-methylbut-3-en-2-yl)cyclohexa-1,5-dien-1-yl]ethanone is C=CC(C)(C)C1=C(OCC=C(C)C)C(C(C)=O)=CCC1.
What is the InChIKey of 1-[6-(3-methylbut-2-enoxy)-5-(2-methylbut-3-en-2-yl)cyclohexa-1,5-dien-1-yl]ethanone?
The InChIKey is WQRREVCOUZXULE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26O2/c1-7-18(5,6)16-10-8-9-15(14(4)19)17(16)20-12-11-13(2)3/h7,9,11H,1,8,10,12H2,2-6H3.
What are the key properties of 1-[6-(3-methylbut-2-enoxy)-5-(2-methylbut-3-en-2-yl)cyclohexa-1,5-dien-1-yl]ethanone?
1-[6-(3-methylbut-2-enoxy)-5-(2-methylbut-3-en-2-yl)cyclohexa-1,5-dien-1-yl]ethanone has a molecular weight of 274.40 g/mol, XLogP of 4.74, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-(3-methylbut-2-enoxy)-5-(2-methylbut-3-en-2-yl)cyclohexa-1,5-dien-1-yl]ethanone is sourced from PubChem (CID 89150085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).