C19H28O3 — CID 89150138
3-butoxy-1-[(3E,5Z)-4-(methoxymethyl)hepta-1,3,5-trien-2-yl]oxycyclohexa-1,3-diene (PubChem CID 89150138) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is 3-butoxy-1-[(3E,5Z)-4-(methoxymethyl)hepta-1,3,5-trien-2-yl]oxycyclohexa-1,3-diene.
| Compound Name | 3-butoxy-1-[(3E,5Z)-4-(methoxymethyl)hepta-1,3,5-trien-2-yl]oxycyclohexa-1,3-diene |
|---|---|
| PubChem CID | 89150138 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 3-butoxy-1-[(3E,5Z)-4-(methoxymethyl)hepta-1,3,5-trien-2-yl]oxycyclohexa-1,3-diene |
| SMILES | C=C(/C=C(\C=C/C)COC)OC1=CC(OCCCC)=CCC1 |
| InChI | InChI=1S/C19H28O3/c1-5-7-12-21-18-10-8-11-19(14-18)22-16(3)13-17(9-6-2)15-20-4/h6,9-10,13-14H,3,5,7-8,11-12,15H2,1-2,4H3/b9-6-,17-13+ |
| InChIKey | CDMDPHURLIJNHH-DMKHZNGKSA-N |
| XLogP | 5.04 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|