About 3-methyl-6-propan-2-yl-3,4-dihydropyridazine
3-methyl-6-propan-2-yl-3,4-dihydropyridazine (PubChem CID 89150342) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is 3-methyl-6-propan-2-yl-3,4-dihydropyridazine.
Molecular Properties
| Compound Name | 3-methyl-6-propan-2-yl-3,4-dihydropyridazine |
| PubChem CID | 89150342 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 3-methyl-6-propan-2-yl-3,4-dihydropyridazine |
| SMILES | CC1CC=C(C(C)C)N=N1 |
| InChI | InChI=1S/C8H14N2/c1-6(2)8-5-4-7(3)9-10-8/h5-7H,4H2,1-3H3 |
| InChIKey | VKXUWZLJINAHTN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-6-propan-2-yl-3,4-dihydropyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-6-propan-2-yl-3,4-dihydropyridazine?
The IUPAC name of 3-methyl-6-propan-2-yl-3,4-dihydropyridazine (CID 89150342) is 3-methyl-6-propan-2-yl-3,4-dihydropyridazine.
What is the SMILES notation for 3-methyl-6-propan-2-yl-3,4-dihydropyridazine?
The canonical SMILES for 3-methyl-6-propan-2-yl-3,4-dihydropyridazine is CC1CC=C(C(C)C)N=N1.
What is the InChIKey of 3-methyl-6-propan-2-yl-3,4-dihydropyridazine?
The InChIKey is VKXUWZLJINAHTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2/c1-6(2)8-5-4-7(3)9-10-8/h5-7H,4H2,1-3H3.
What are the key properties of 3-methyl-6-propan-2-yl-3,4-dihydropyridazine?
3-methyl-6-propan-2-yl-3,4-dihydropyridazine has a molecular weight of 138.21 g/mol, XLogP of 2.77, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-6-propan-2-yl-3,4-dihydropyridazine is sourced from PubChem (CID 89150342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).