C9H18N2 — CID 89150495
(2Z,4Z)-3-propan-2-ylhexa-2,4-diene-1,6-diamine (PubChem CID 89150495) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is (2Z,4Z)-3-propan-2-ylhexa-2,4-diene-1,6-diamine.
| Compound Name | (2Z,4Z)-3-propan-2-ylhexa-2,4-diene-1,6-diamine |
|---|---|
| PubChem CID | 89150495 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | (2Z,4Z)-3-propan-2-ylhexa-2,4-diene-1,6-diamine |
| SMILES | CC(C)C(/C=C\CN)=C/CN |
| InChI | InChI=1S/C9H18N2/c1-8(2)9(5-7-11)4-3-6-10/h3-5,8H,6-7,10-11H2,1-2H3/b4-3-,9-5+ |
| InChIKey | MMBURVDQGCETAR-XBURUKCPSA-N |
| XLogP | 1.04 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|