About amino 3-(2,5-dioxopyrrol-1-yl)propanoate
amino 3-(2,5-dioxopyrrol-1-yl)propanoate (PubChem CID 89150560) has the molecular formula C7H8N2O4
and a molecular weight of 184.15 g/mol. Its IUPAC name is amino 3-(2,5-dioxopyrrol-1-yl)propanoate.
Molecular Properties
| Compound Name | amino 3-(2,5-dioxopyrrol-1-yl)propanoate |
| PubChem CID | 89150560 |
| Molecular Formula | C7H8N2O4 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | amino 3-(2,5-dioxopyrrol-1-yl)propanoate |
| SMILES | NOC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C7H8N2O4/c8-13-7(12)3-4-9-5(10)1-2-6(9)11/h1-2H,3-4,8H2 |
| InChIKey | UIKNDOUJHRDNSD-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze amino 3-(2,5-dioxopyrrol-1-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino 3-(2,5-dioxopyrrol-1-yl)propanoate?
The IUPAC name of amino 3-(2,5-dioxopyrrol-1-yl)propanoate (CID 89150560) is amino 3-(2,5-dioxopyrrol-1-yl)propanoate.
What is the SMILES notation for amino 3-(2,5-dioxopyrrol-1-yl)propanoate?
The canonical SMILES for amino 3-(2,5-dioxopyrrol-1-yl)propanoate is NOC(=O)CCN1C(=O)C=CC1=O.
What is the InChIKey of amino 3-(2,5-dioxopyrrol-1-yl)propanoate?
The InChIKey is UIKNDOUJHRDNSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O4/c8-13-7(12)3-4-9-5(10)1-2-6(9)11/h1-2H,3-4,8H2.
What are the key properties of amino 3-(2,5-dioxopyrrol-1-yl)propanoate?
amino 3-(2,5-dioxopyrrol-1-yl)propanoate has a molecular weight of 184.15 g/mol, XLogP of -1.28, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for amino 3-(2,5-dioxopyrrol-1-yl)propanoate is sourced from PubChem (CID 89150560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).