C16H22F2O5S — CID 89150609
1,1-difluoro-2-(tetracyclo[6.2.1.13,6.02,7]dodecane-4-carbonyloxy)propane-1-sulfonic acid (PubChem CID 89150609) has the molecular formula C16H22F2O5S and a molecular weight of 364.41 g/mol. Its IUPAC name is 1,1-difluoro-2-(tetracyclo[6.2.1.13,6.02,7]dodecane-4-carbonyloxy)propane-1-sulfonic acid.
| Compound Name | 1,1-difluoro-2-(tetracyclo[6.2.1.13,6.02,7]dodecane-4-carbonyloxy)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 89150609 |
| Molecular Formula | C16H22F2O5S |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 1,1-difluoro-2-(tetracyclo[6.2.1.13,6.02,7]dodecane-4-carbonyloxy)propane-1-sulfonic acid |
| SMILES | CC(OC(=O)C1CC2CC1C1C3CCC(C3)C21)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C16H22F2O5S/c1-7(16(17,18)24(20,21)22)23-15(19)12-6-10-5-11(12)14-9-3-2-8(4-9)13(10)14/h7-14H,2-6H2,1H3,(H,20,21,22) |
| InChIKey | QFIJTFPYQCIPGS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|