C11H12N2O13S2 — CID 89150627
4-methyl-1-[3-methyl-2,5-dioxo-4-(trioxidanylsulfanyl)pyrrolidin-1-yl]oxycarbonyloxy-2,5-dioxopyrrolidine-3-sulfonic acid (PubChem CID 89150627) has the molecular formula C11H12N2O13S2 and a molecular weight of 444.35 g/mol. Its IUPAC name is 4-methyl-1-[3-methyl-2,5-dioxo-4-(trioxidanylsulfanyl)pyrrolidin-1-yl]oxycarbonyloxy-2,5-dioxopyrrolidine-3-sulfonic acid.
| Compound Name | 4-methyl-1-[3-methyl-2,5-dioxo-4-(trioxidanylsulfanyl)pyrrolidin-1-yl]oxycarbonyloxy-2,5-dioxopyrrolidine-3-sulfonic acid |
|---|---|
| PubChem CID | 89150627 |
| Molecular Formula | C11H12N2O13S2 |
| Molecular Weight | 444.35 g/mol |
| Exact Mass | 443.98 |
| IUPAC Name | 4-methyl-1-[3-methyl-2,5-dioxo-4-(trioxidanylsulfanyl)pyrrolidin-1-yl]oxycarbonyloxy-2,5-dioxopyrrolidine-3-sulfonic acid |
| SMILES | CC1C(=O)N(OC(=O)ON2C(=O)C(C)C(S(=O)(=O)O)C2=O)C(=O)C1SOOO |
| InChI | InChI=1S/C11H12N2O13S2/c1-3-5(27-26-25-19)9(16)12(7(3)14)23-11(18)24-13-8(15)4(2)6(10(13)17)28(20,21)22/h3-6,19H,1-2H3,(H,20,21,22) |
| InChIKey | CGCOQKVDYSUCNH-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 203.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.35 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|