About 4-(1-hydroxyethyl)-1,6,6-trimethyl-3-oxabicyclo[3.2.0]heptan-2-one
4-(1-hydroxyethyl)-1,6,6-trimethyl-3-oxabicyclo[3.2.0]heptan-2-one (PubChem CID 89150759) has the molecular formula C11H18O3
and a molecular weight of 198.26 g/mol. Its IUPAC name is 4-(1-hydroxyethyl)-1,6,6-trimethyl-3-oxabicyclo[3.2.0]heptan-2-one.
Molecular Properties
| Compound Name | 4-(1-hydroxyethyl)-1,6,6-trimethyl-3-oxabicyclo[3.2.0]heptan-2-one |
| PubChem CID | 89150759 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 4-(1-hydroxyethyl)-1,6,6-trimethyl-3-oxabicyclo[3.2.0]heptan-2-one |
| SMILES | CC(O)C1OC(=O)C2(C)CC(C)(C)C12 |
| InChI | InChI=1S/C11H18O3/c1-6(12)7-8-10(2,3)5-11(8,4)9(13)14-7/h6-8,12H,5H2,1-4H3 |
| InChIKey | YGQQPZYOHUZOPV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(1-hydroxyethyl)-1,6,6-trimethyl-3-oxabicyclo[3.2.0]heptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-hydroxyethyl)-1,6,6-trimethyl-3-oxabicyclo[3.2.0]heptan-2-one?
The IUPAC name of 4-(1-hydroxyethyl)-1,6,6-trimethyl-3-oxabicyclo[3.2.0]heptan-2-one (CID 89150759) is 4-(1-hydroxyethyl)-1,6,6-trimethyl-3-oxabicyclo[3.2.0]heptan-2-one.
What is the SMILES notation for 4-(1-hydroxyethyl)-1,6,6-trimethyl-3-oxabicyclo[3.2.0]heptan-2-one?
The canonical SMILES for 4-(1-hydroxyethyl)-1,6,6-trimethyl-3-oxabicyclo[3.2.0]heptan-2-one is CC(O)C1OC(=O)C2(C)CC(C)(C)C12.
What is the InChIKey of 4-(1-hydroxyethyl)-1,6,6-trimethyl-3-oxabicyclo[3.2.0]heptan-2-one?
The InChIKey is YGQQPZYOHUZOPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O3/c1-6(12)7-8-10(2,3)5-11(8,4)9(13)14-7/h6-8,12H,5H2,1-4H3.
What are the key properties of 4-(1-hydroxyethyl)-1,6,6-trimethyl-3-oxabicyclo[3.2.0]heptan-2-one?
4-(1-hydroxyethyl)-1,6,6-trimethyl-3-oxabicyclo[3.2.0]heptan-2-one has a molecular weight of 198.26 g/mol, XLogP of 1.35, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-hydroxyethyl)-1,6,6-trimethyl-3-oxabicyclo[3.2.0]heptan-2-one is sourced from PubChem (CID 89150759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).