About 3-(3-hydroxypropyl)pentane-2,4-dione
3-(3-hydroxypropyl)pentane-2,4-dione (PubChem CID 89151171) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is 3-(3-hydroxypropyl)pentane-2,4-dione.
Molecular Properties
| Compound Name | 3-(3-hydroxypropyl)pentane-2,4-dione |
| PubChem CID | 89151171 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 3-(3-hydroxypropyl)pentane-2,4-dione |
| SMILES | CC(=O)C(CCCO)C(C)=O |
| InChI | InChI=1S/C8H14O3/c1-6(10)8(7(2)11)4-3-5-9/h8-9H,3-5H2,1-2H3 |
| InChIKey | NBMOUDCRMOGZPY-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-hydroxypropyl)pentane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-hydroxypropyl)pentane-2,4-dione?
The IUPAC name of 3-(3-hydroxypropyl)pentane-2,4-dione (CID 89151171) is 3-(3-hydroxypropyl)pentane-2,4-dione.
What is the SMILES notation for 3-(3-hydroxypropyl)pentane-2,4-dione?
The canonical SMILES for 3-(3-hydroxypropyl)pentane-2,4-dione is CC(=O)C(CCCO)C(C)=O.
What is the InChIKey of 3-(3-hydroxypropyl)pentane-2,4-dione?
The InChIKey is NBMOUDCRMOGZPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3/c1-6(10)8(7(2)11)4-3-5-9/h8-9H,3-5H2,1-2H3.
What are the key properties of 3-(3-hydroxypropyl)pentane-2,4-dione?
3-(3-hydroxypropyl)pentane-2,4-dione has a molecular weight of 158.20 g/mol, XLogP of 0.55, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-hydroxypropyl)pentane-2,4-dione is sourced from PubChem (CID 89151171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).