C23H13F9N2O3 — CID 89151272
[(E)-(12-prop-2-enoyl-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10(15),11,13-hexaen-4-ylidene)amino] 2,2,3,3,4,4,5,5,5-nonafluoropentanoate (PubChem CID 89151272) has the molecular formula C23H13F9N2O3 and a molecular weight of 536.35 g/mol. Its IUPAC name is [(E)-(12-prop-2-enoyl-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10(15),11,13-hexaen-4-ylidene)amino] 2,2,3,3,4,4,5,5,5-nonafluoropentanoate.
| Compound Name | [(E)-(12-prop-2-enoyl-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10(15),11,13-hexaen-4-ylidene)amino] 2,2,3,3,4,4,5,5,5-nonafluoropentanoate |
|---|---|
| PubChem CID | 89151272 |
| Molecular Formula | C23H13F9N2O3 |
| Molecular Weight | 536.35 g/mol |
| Exact Mass | 536.08 |
| IUPAC Name | [(E)-(12-prop-2-enoyl-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10(15),11,13-hexaen-4-ylidene)amino] 2,2,3,3,4,4,5,5,5-nonafluoropentanoate |
| SMILES | C=CC(=O)c1ccc2c(c1)c1cccc3c1n2CC/C3=N\OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C23H13F9N2O3/c1-2-17(35)11-6-7-16-14(10-11)12-4-3-5-13-15(8-9-34(16)18(12)13)33-37-19(36)20(24,25)21(26,27)22(28,29)23(30,31)32/h2-7,10H,1,8-9H2/b33-15+ |
| InChIKey | WWHHRYLALWXMFR-ROPCREHHSA-N |
| XLogP | 6.28 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.35 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|