C19H16N2O3 — CID 89151378
[(E)-(6-methyl-8-oxo-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9(17),10,12-hexaen-14-ylidene)amino] acetate (PubChem CID 89151378) has the molecular formula C19H16N2O3 and a molecular weight of 320.35 g/mol. Its IUPAC name is [(E)-(6-methyl-8-oxo-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9(17),10,12-hexaen-14-ylidene)amino] acetate.
| Compound Name | [(E)-(6-methyl-8-oxo-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9(17),10,12-hexaen-14-ylidene)amino] acetate |
|---|---|
| PubChem CID | 89151378 |
| Molecular Formula | C19H16N2O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | [(E)-(6-methyl-8-oxo-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2,4,6,9(17),10,12-hexaen-14-ylidene)amino] acetate |
| SMILES | CC(=O)O/N=C1\CCn2c3cccc(C)c3c(=O)c3cccc1c32 |
| InChI | InChI=1S/C19H16N2O3/c1-11-5-3-8-16-17(11)19(23)14-7-4-6-13-15(20-24-12(2)22)9-10-21(16)18(13)14/h3-8H,9-10H2,1-2H3/b20-15+ |
| InChIKey | GVWJIHYTOWLYBS-HMMYKYKNSA-N |
| XLogP | 3.13 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|