C19H29NO — CID 89151483
(2E,4Z,6E)-7-[(3Z)-hexa-3,5-dienoxy]-5-methyl-2-propylidenenona-4,6,8-trien-1-amine (PubChem CID 89151483) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is (2E,4Z,6E)-7-[(3Z)-hexa-3,5-dienoxy]-5-methyl-2-propylidenenona-4,6,8-trien-1-amine.
| Compound Name | (2E,4Z,6E)-7-[(3Z)-hexa-3,5-dienoxy]-5-methyl-2-propylidenenona-4,6,8-trien-1-amine |
|---|---|
| PubChem CID | 89151483 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | (2E,4Z,6E)-7-[(3Z)-hexa-3,5-dienoxy]-5-methyl-2-propylidenenona-4,6,8-trien-1-amine |
| SMILES | C=C/C=C\CCO/C(C=C)=C/C(C)=C\C/C(=C\CC)CN |
| InChI | InChI=1S/C19H29NO/c1-5-8-9-10-14-21-19(7-3)15-17(4)12-13-18(16-20)11-6-2/h5,7-9,11-12,15H,1,3,6,10,13-14,16,20H2,2,4H3/b9-8-,17-12-,18-11+,19-15+ |
| InChIKey | ISRMAMPMZWMNOA-LILLGLJHSA-N |
| XLogP | 4.84 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|