C18H32O — CID 89151509
(3E,5E)-2,3,10-trimethyl-5-(2-methylpropoxy)undeca-1,3,5-triene (PubChem CID 89151509) has the molecular formula C18H32O and a molecular weight of 264.45 g/mol. Its IUPAC name is (3E,5E)-2,3,10-trimethyl-5-(2-methylpropoxy)undeca-1,3,5-triene.
| Compound Name | (3E,5E)-2,3,10-trimethyl-5-(2-methylpropoxy)undeca-1,3,5-triene |
|---|---|
| PubChem CID | 89151509 |
| Molecular Formula | C18H32O |
| Molecular Weight | 264.45 g/mol |
| Exact Mass | 264.25 |
| IUPAC Name | (3E,5E)-2,3,10-trimethyl-5-(2-methylpropoxy)undeca-1,3,5-triene |
| SMILES | C=C(C)/C(C)=C/C(=C\CCCC(C)C)OCC(C)C |
| InChI | InChI=1S/C18H32O/c1-14(2)10-8-9-11-18(19-13-15(3)4)12-17(7)16(5)6/h11-12,14-15H,5,8-10,13H2,1-4,6-7H3/b17-12+,18-11+ |
| InChIKey | CGZVHFDMGAFRFK-VQVMMYKWSA-N |
| XLogP | 5.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.45 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|