C29H31F6NO5 — CID 89151964
1-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-3-(2-methoxyphenyl)-3-methylpyridine-2,6-dione (PubChem CID 89151964) has the molecular formula C29H31F6NO5 and a molecular weight of 587.56 g/mol. Its IUPAC name is 1-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-3-(2-methoxyphenyl)-3-methylpyridine-2,6-dione.
| Compound Name | 1-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-3-(2-methoxyphenyl)-3-methylpyridine-2,6-dione |
|---|---|
| PubChem CID | 89151964 |
| Molecular Formula | C29H31F6NO5 |
| Molecular Weight | 587.56 g/mol |
| Exact Mass | 587.21 |
| IUPAC Name | 1-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-3-(2-methoxyphenyl)-3-methylpyridine-2,6-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1OCCCCN1C(=O)C=CC(C)(c2ccccc2OC)C1=O |
| InChI | InChI=1S/C29H31F6NO5/c1-4-9-19-18-20(27(39,28(30,31)32)29(33,34)35)12-13-22(19)41-17-8-7-16-36-24(37)14-15-26(2,25(36)38)21-10-5-6-11-23(21)40-3/h5-6,10-15,18,39H,4,7-9,16-17H2,1-3H3 |
| InChIKey | YGWIHJJHPWFTAU-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.56 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|