About tert-butyl 7-(nitrosomethyl)-2,3-dihydroindole-1-carboxylate
tert-butyl 7-(nitrosomethyl)-2,3-dihydroindole-1-carboxylate (PubChem CID 89152421) has the molecular formula C14H18N2O3
and a molecular weight of 262.31 g/mol. Its IUPAC name is tert-butyl 7-(nitrosomethyl)-2,3-dihydroindole-1-carboxylate.
Analyze tert-butyl 7-(nitrosomethyl)-2,3-dihydroindole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 7-(nitrosomethyl)-2,3-dihydroindole-1-carboxylate?
The IUPAC name of tert-butyl 7-(nitrosomethyl)-2,3-dihydroindole-1-carboxylate (CID 89152421) is tert-butyl 7-(nitrosomethyl)-2,3-dihydroindole-1-carboxylate.
What is the SMILES notation for tert-butyl 7-(nitrosomethyl)-2,3-dihydroindole-1-carboxylate?
The canonical SMILES for tert-butyl 7-(nitrosomethyl)-2,3-dihydroindole-1-carboxylate is CC(C)(C)OC(=O)N1CCc2cccc(CN=O)c21.
What is the InChIKey of tert-butyl 7-(nitrosomethyl)-2,3-dihydroindole-1-carboxylate?
The InChIKey is PSOHQTQJZBQGCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O3/c1-14(2,3)19-13(17)16-8-7-10-5-4-6-11(9-15-18)12(10)16/h4-6H,7-9H2,1-3H3.
What are the key properties of tert-butyl 7-(nitrosomethyl)-2,3-dihydroindole-1-carboxylate?
tert-butyl 7-(nitrosomethyl)-2,3-dihydroindole-1-carboxylate has a molecular weight of 262.31 g/mol, XLogP of 3.25, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 7-(nitrosomethyl)-2,3-dihydroindole-1-carboxylate is sourced from PubChem (CID 89152421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).