C18H14N2O2S2 — CID 89152506
(1S,2R)-6-methoxy-1'-(1,3-thiazol-2-yl)-1-thiophen-2-ylspiro[1,3-dihydroindene-2,3'-aziridine]-2'-one (PubChem CID 89152506) has the molecular formula C18H14N2O2S2 and a molecular weight of 354.46 g/mol. Its IUPAC name is (1S,2R)-6-methoxy-1'-(1,3-thiazol-2-yl)-1-thiophen-2-ylspiro[1,3-dihydroindene-2,3'-aziridine]-2'-one.
| Compound Name | (1S,2R)-6-methoxy-1'-(1,3-thiazol-2-yl)-1-thiophen-2-ylspiro[1,3-dihydroindene-2,3'-aziridine]-2'-one |
|---|---|
| PubChem CID | 89152506 |
| Molecular Formula | C18H14N2O2S2 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | (1S,2R)-6-methoxy-1'-(1,3-thiazol-2-yl)-1-thiophen-2-ylspiro[1,3-dihydroindene-2,3'-aziridine]-2'-one |
| SMILES | COc1ccc2c(c1)[C@H](c1cccs1)[C@]1(C2)C(=O)N1c1nccs1 |
| InChI | InChI=1S/C18H14N2O2S2/c1-22-12-5-4-11-10-18(16(21)20(18)17-19-6-8-24-17)15(13(11)9-12)14-3-2-7-23-14/h2-9,15H,10H2,1H3/t15-,18-,20?/m1/s1 |
| InChIKey | WCADJNYWKVJJBQ-ILPDQNMUSA-N |
| XLogP | 3.69 |
| TPSA | 42.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|