About (1E,3Z)-1-fluorobuta-1,3-diene-1,4-diamine
(1E,3Z)-1-fluorobuta-1,3-diene-1,4-diamine (PubChem CID 89152800) has the molecular formula C4H7FN2
and a molecular weight of 102.11 g/mol. Its IUPAC name is (1E,3Z)-1-fluorobuta-1,3-diene-1,4-diamine.
Molecular Properties
| Compound Name | (1E,3Z)-1-fluorobuta-1,3-diene-1,4-diamine |
| PubChem CID | 89152800 |
| Molecular Formula | C4H7FN2 |
| Molecular Weight | 102.11 g/mol |
| Exact Mass | 102.06 |
| IUPAC Name | (1E,3Z)-1-fluorobuta-1,3-diene-1,4-diamine |
| SMILES | N/C=C\C=C(/N)F |
| InChI | InChI=1S/C4H7FN2/c5-4(7)2-1-3-6/h1-3H,6-7H2/b3-1-,4-2- |
| InChIKey | FCFSEUGDLSOMIE-CCAGOZQPSA-N |
| XLogP | 0.23 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.11 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1E,3Z)-1-fluorobuta-1,3-diene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E,3Z)-1-fluorobuta-1,3-diene-1,4-diamine?
The IUPAC name of (1E,3Z)-1-fluorobuta-1,3-diene-1,4-diamine (CID 89152800) is (1E,3Z)-1-fluorobuta-1,3-diene-1,4-diamine.
What is the SMILES notation for (1E,3Z)-1-fluorobuta-1,3-diene-1,4-diamine?
The canonical SMILES for (1E,3Z)-1-fluorobuta-1,3-diene-1,4-diamine is N/C=C\C=C(/N)F.
What is the InChIKey of (1E,3Z)-1-fluorobuta-1,3-diene-1,4-diamine?
The InChIKey is FCFSEUGDLSOMIE-CCAGOZQPSA-N. The full InChI is InChI=1S/C4H7FN2/c5-4(7)2-1-3-6/h1-3H,6-7H2/b3-1-,4-2-.
What are the key properties of (1E,3Z)-1-fluorobuta-1,3-diene-1,4-diamine?
(1E,3Z)-1-fluorobuta-1,3-diene-1,4-diamine has a molecular weight of 102.11 g/mol, XLogP of 0.23, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1E,3Z)-1-fluorobuta-1,3-diene-1,4-diamine is sourced from PubChem (CID 89152800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).