About 7-phenyl-7,8-diazabicyclo[4.2.0]octa-1,3,5-triene
7-phenyl-7,8-diazabicyclo[4.2.0]octa-1,3,5-triene (PubChem CID 89152837) has the molecular formula C12H10N2
and a molecular weight of 182.23 g/mol. Its IUPAC name is 7-phenyl-7,8-diazabicyclo[4.2.0]octa-1,3,5-triene.
Molecular Properties
| Compound Name | 7-phenyl-7,8-diazabicyclo[4.2.0]octa-1,3,5-triene |
| PubChem CID | 89152837 |
| Molecular Formula | C12H10N2 |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 7-phenyl-7,8-diazabicyclo[4.2.0]octa-1,3,5-triene |
| SMILES | c1ccc(-n2[nH]c3ccccc32)cc1 |
| InChI | InChI=1S/C12H10N2/c1-2-6-10(7-3-1)14-12-9-5-4-8-11(12)13-14/h1-9,13H |
| InChIKey | YLBKDPLURFLNAX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-phenyl-7,8-diazabicyclo[4.2.0]octa-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-phenyl-7,8-diazabicyclo[4.2.0]octa-1,3,5-triene?
The IUPAC name of 7-phenyl-7,8-diazabicyclo[4.2.0]octa-1,3,5-triene (CID 89152837) is 7-phenyl-7,8-diazabicyclo[4.2.0]octa-1,3,5-triene.
What is the SMILES notation for 7-phenyl-7,8-diazabicyclo[4.2.0]octa-1,3,5-triene?
The canonical SMILES for 7-phenyl-7,8-diazabicyclo[4.2.0]octa-1,3,5-triene is c1ccc(-n2[nH]c3ccccc32)cc1.
What is the InChIKey of 7-phenyl-7,8-diazabicyclo[4.2.0]octa-1,3,5-triene?
The InChIKey is YLBKDPLURFLNAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2/c1-2-6-10(7-3-1)14-12-9-5-4-8-11(12)13-14/h1-9,13H.
What are the key properties of 7-phenyl-7,8-diazabicyclo[4.2.0]octa-1,3,5-triene?
7-phenyl-7,8-diazabicyclo[4.2.0]octa-1,3,5-triene has a molecular weight of 182.23 g/mol, XLogP of 2.96, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-phenyl-7,8-diazabicyclo[4.2.0]octa-1,3,5-triene is sourced from PubChem (CID 89152837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).