C26H30N4O2 — CID 89153029
(6S,9aS)-8-(2,2-diphenylethyl)-6-propan-2-yl-2-prop-2-ynyl-3,6,9,9a-tetrahydro-1H-pyrazino[2,1-c][1,2,4]triazine-4,7-dione (PubChem CID 89153029) has the molecular formula C26H30N4O2 and a molecular weight of 430.55 g/mol. Its IUPAC name is (6S,9aS)-8-(2,2-diphenylethyl)-6-propan-2-yl-2-prop-2-ynyl-3,6,9,9a-tetrahydro-1H-pyrazino[2,1-c][1,2,4]triazine-4,7-dione.
| Compound Name | (6S,9aS)-8-(2,2-diphenylethyl)-6-propan-2-yl-2-prop-2-ynyl-3,6,9,9a-tetrahydro-1H-pyrazino[2,1-c][1,2,4]triazine-4,7-dione |
|---|---|
| PubChem CID | 89153029 |
| Molecular Formula | C26H30N4O2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | (6S,9aS)-8-(2,2-diphenylethyl)-6-propan-2-yl-2-prop-2-ynyl-3,6,9,9a-tetrahydro-1H-pyrazino[2,1-c][1,2,4]triazine-4,7-dione |
| SMILES | C#CCN1CC(=O)N2[C@H](CN(CC(c3ccccc3)c3ccccc3)C(=O)[C@@H]2C(C)C)N1 |
| InChI | InChI=1S/C26H30N4O2/c1-4-15-29-18-24(31)30-23(27-29)17-28(26(32)25(30)19(2)3)16-22(20-11-7-5-8-12-20)21-13-9-6-10-14-21/h1,5-14,19,22-23,25,27H,15-18H2,2-3H3/t23-,25+/m1/s1 |
| InChIKey | KIHTWMBPLDZGIC-NOZRDPDXSA-N |
| XLogP | 2.29 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|