C28H34O2 — CID 89153161
1,4,5,6,7,8-hexaethylanthracene-2,3-dicarbaldehyde (PubChem CID 89153161) has the molecular formula C28H34O2 and a molecular weight of 402.58 g/mol. Its IUPAC name is 1,4,5,6,7,8-hexaethylanthracene-2,3-dicarbaldehyde.
| Compound Name | 1,4,5,6,7,8-hexaethylanthracene-2,3-dicarbaldehyde |
|---|---|
| PubChem CID | 89153161 |
| Molecular Formula | C28H34O2 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | 1,4,5,6,7,8-hexaethylanthracene-2,3-dicarbaldehyde |
| SMILES | CCc1c(CC)c(CC)c2cc3c(CC)c(C=O)c(C=O)c(CC)c3cc2c1CC |
| InChI | InChI=1S/C28H34O2/c1-7-17-18(8-2)20(10-4)24-14-26-22(12-6)28(16-30)27(15-29)21(11-5)25(26)13-23(24)19(17)9-3/h13-16H,7-12H2,1-6H3 |
| InChIKey | AZDNAHHYJQIQNT-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|